C36H39FO9S2 — CID 22057372
[3,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;4-fluorobenzenesulfonate (PubChem CID 22057372) has the molecular formula C36H39FO9S2 and a molecular weight of 698.83 g/mol. Its IUPAC name is [3,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;4-fluorobenzenesulfonate.
| Compound Name | [3,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 22057372 |
| Molecular Formula | C36H39FO9S2 |
| Molecular Weight | 698.83 g/mol |
| Exact Mass | 698.20 |
| IUPAC Name | [3,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;4-fluorobenzenesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1cc(OCC(=O)OC(C)(C)C)cc([S+](c2ccccc2)c2ccccc2)c1.O=S(=O)([O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C30H35O6S.C6H5FO3S/c1-29(2,3)35-27(31)20-33-22-17-23(34-21-28(32)36-30(4,5)6)19-26(18-22)37(24-13-9-7-10-14-24)25-15-11-8-12-16-25;7-5-1-3-6(4-2-5)11(8,9)10/h7-19H,20-21H2,1-6H3;1-4H,(H,8,9,10)/q+1;/p-1 |
| InChIKey | QJHGENWHSJFOFI-UHFFFAOYSA-M |
| XLogP | 6.95 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.83 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|