C36H45O9S+ — CID 22057125
diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium (PubChem CID 22057125) has the molecular formula C36H45O9S+ and a molecular weight of 653.81 g/mol. Its IUPAC name is diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium.
| Compound Name | diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 22057125 |
| Molecular Formula | C36H45O9S+ |
| Molecular Weight | 653.81 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium |
| SMILES | CC(C)(C)OC(=O)COc1cc(OCC(=O)OC(C)(C)C)c([S+](c2ccccc2)c2ccccc2)c(OCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C36H45O9S/c1-34(2,3)43-30(37)22-40-25-20-28(41-23-31(38)44-35(4,5)6)33(29(21-25)42-24-32(39)45-36(7,8)9)46(26-16-12-10-13-17-26)27-18-14-11-15-19-27/h10-21H,22-24H2,1-9H3/q+1 |
| InChIKey | MUGBBKORLCDPRY-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.81 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|