C31H37O7S+ — CID 22901762
(3-methoxyphenyl)-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium (PubChem CID 22901762) has the molecular formula C31H37O7S+ and a molecular weight of 553.70 g/mol. Its IUPAC name is (3-methoxyphenyl)-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium.
| Compound Name | (3-methoxyphenyl)-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 22901762 |
| Molecular Formula | C31H37O7S+ |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | (3-methoxyphenyl)-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium |
| SMILES | COc1cccc([S+](c2ccc(OCC(=O)OC(C)(C)C)cc2)c2ccc(OCC(=O)OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C31H37O7S/c1-30(2,3)37-28(32)20-35-22-11-15-25(16-12-22)39(27-10-8-9-24(19-27)34-7)26-17-13-23(14-18-26)36-21-29(33)38-31(4,5)6/h8-19H,20-21H2,1-7H3/q+1 |
| InChIKey | MAACTYKEEYPAGA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|