C40H47F7O12S2 — CID 18945761
2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate;tris[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium (PubChem CID 18945761) has the molecular formula C40H47F7O12S2 and a molecular weight of 916.92 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate;tris[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate;tris[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 18945761 |
| Molecular Formula | C40H47F7O12S2 |
| Molecular Weight | 916.92 g/mol |
| Exact Mass | 916.24 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate;tris[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium |
| SMILES | CC(C)(C)OC(=O)COc1cccc([S+](c2cccc(OCC(=O)OC(C)(C)C)c2)c2cccc(OCC(=O)OC(C)(C)C)c2)c1.O=S(=O)([O-])CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C36H45O9S.C4H3F7O3S/c1-34(2,3)43-31(37)22-40-25-13-10-16-28(19-25)46(29-17-11-14-26(20-29)41-23-32(38)44-35(4,5)6)30-18-12-15-27(21-30)42-24-33(39)45-36(7,8)9;5-2(6,1-15(12,13)14)3(7,8)4(9,10)11/h10-21H,22-24H2,1-9H3;1H2,(H,12,13,14)/q+1;/p-1 |
| InChIKey | PZPAPLNLGIBPCG-UHFFFAOYSA-M |
| XLogP | 8.31 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.92 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|