C40H50O10S2 — CID 159523688
bis[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-phenylsulfanium;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 159523688) has the molecular formula C40H50O10S2 and a molecular weight of 754.96 g/mol. Its IUPAC name is bis[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-phenylsulfanium;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | bis[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-phenylsulfanium;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 159523688 |
| Molecular Formula | C40H50O10S2 |
| Molecular Weight | 754.96 g/mol |
| Exact Mass | 754.28 |
| IUPAC Name | bis[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-phenylsulfanium;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1cccc([S+](c2ccccc2)c2cccc(OCC(=O)OC(C)(C)C)c2)c1.CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2 |
| InChI | InChI=1S/C30H35O6S.C10H16O4S/c1-29(2,3)35-27(31)20-33-22-12-10-16-25(18-22)37(24-14-8-7-9-15-24)26-17-11-13-23(19-26)34-21-28(32)36-30(4,5)6;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7-19H,20-21H2,1-6H3;7H,3-6H2,1-2H3,(H,12,13,14)/q+1;/p-1 |
| InChIKey | MCCWPGNGSPXXGD-UHFFFAOYSA-M |
| XLogP | 7.15 |
| TPSA | 145.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.96 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|