C43H54O13S2 — CID 139752136
[tris[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 139752136) has the molecular formula C43H54O13S2 and a molecular weight of 843.03 g/mol. Its IUPAC name is [tris[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | [tris[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 139752136 |
| Molecular Formula | C43H54O13S2 |
| Molecular Weight | 843.03 g/mol |
| Exact Mass | 842.30 |
| IUPAC Name | [tris[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC(C)(C)OC(=O)Oc1cccc(S(OS(=O)(=O)CC23CCC(CC2=O)C3(C)C)(c2cccc(OC(=O)OC(C)(C)C)c2)c2cccc(OC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C43H54O13S2/c1-39(2,3)53-36(45)50-29-15-12-18-32(24-29)58(33-19-13-16-30(25-33)51-37(46)54-40(4,5)6,34-20-14-17-31(26-34)52-38(47)55-41(7,8)9)56-57(48,49)27-43-22-21-28(23-35(43)44)42(43,10)11/h12-20,24-26,28H,21-23,27H2,1-11H3 |
| InChIKey | GYCFARLFZWQSIG-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.03 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|