C28H38Na2O8S2 — CID 175872146
CID 175872146 (PubChem CID 175872146) has the molecular formula C28H38Na2O8S2 and a molecular weight of 612.72 g/mol.
| Compound Name | CID 175872146 |
|---|---|
| PubChem CID | 175872146 |
| Molecular Formula | C28H38Na2O8S2 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | — |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)OCc1ccc(COS(=O)(=O)CC34CCC(CC3=O)C4(C)C)cc1)C(=O)C2.[Na].[Na] |
| InChI | InChI=1S/C28H38O8S2.2Na/c1-25(2)21-9-11-27(25,23(29)13-21)17-37(31,32)35-15-19-5-7-20(8-6-19)16-36-38(33,34)18-28-12-10-22(14-24(28)30)26(28,3)4;;/h5-8,21-22H,9-18H2,1-4H3;; |
| InChIKey | QZTGMSGCMDZAKV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|