C10H15BiO4S — CID 53427530
CID 53427530 (PubChem CID 53427530) has the molecular formula C10H15BiO4S and a molecular weight of 440.27 g/mol.
| Compound Name | CID 53427530 |
|---|---|
| PubChem CID | 53427530 |
| Molecular Formula | C10H15BiO4S |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | — |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O[Bi])C(=O)C2 |
| InChI | InChI=1S/C10H16O4S.Bi/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;/h7H,3-6H2,1-2H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | IXOCNACBGKRTOT-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |