C20H27NO6S — CID 89006828
[2,5-dioxo-3,4-di(propan-2-ylidene)pyrrolidin-1-yl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 89006828) has the molecular formula C20H27NO6S and a molecular weight of 409.50 g/mol. Its IUPAC name is [2,5-dioxo-3,4-di(propan-2-ylidene)pyrrolidin-1-yl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | [2,5-dioxo-3,4-di(propan-2-ylidene)pyrrolidin-1-yl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 89006828 |
| Molecular Formula | C20H27NO6S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [2,5-dioxo-3,4-di(propan-2-ylidene)pyrrolidin-1-yl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC(C)=C1C(=O)N(OS(=O)(=O)CC23CCC(CC2=O)C3(C)C)C(=O)C1=C(C)C |
| InChI | InChI=1S/C20H27NO6S/c1-11(2)15-16(12(3)4)18(24)21(17(15)23)27-28(25,26)10-20-8-7-13(9-14(20)22)19(20,5)6/h13H,7-10H2,1-6H3 |
| InChIKey | BONKLIGBDOTHEC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|