C11H17NO5S — CID 91476329
(1S)-1-[(2-hydroxyoxaziridin-3-yl)sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 91476329) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is (1S)-1-[(2-hydroxyoxaziridin-3-yl)sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S)-1-[(2-hydroxyoxaziridin-3-yl)sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 91476329 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (1S)-1-[(2-hydroxyoxaziridin-3-yl)sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CC[C@@]1(CS(=O)(=O)C1ON1O)C(=O)C2 |
| InChI | InChI=1S/C11H17NO5S/c1-10(2)7-3-4-11(10,8(13)5-7)6-18(15,16)9-12(14)17-9/h7,9,14H,3-6H2,1-2H3/t7?,9?,11-,12?/m1/s1 |
| InChIKey | UEJPUYWARQLDPF-GOGUZSOMSA-N |
| XLogP | 0.72 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|