C24H42N2O8S2 — CID 12744169
bis([(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid);piperazine (PubChem CID 12744169) has the molecular formula C24H42N2O8S2 and a molecular weight of 550.74 g/mol. Its IUPAC name is bis([(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid);piperazine.
| Compound Name | bis([(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid);piperazine |
|---|---|
| PubChem CID | 12744169 |
| Molecular Formula | C24H42N2O8S2 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | bis([(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid);piperazine |
| SMILES | C1CNCCN1.CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2.CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2 |
| InChI | InChI=1S/2C10H16O4S.C4H10N2/c2*1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;1-2-6-4-3-5-1/h2*7H,3-6H2,1-2H3,(H,12,13,14);5-6H,1-4H2/t2*7-,10-;/m11./s1 |
| InChIKey | UZOOAVYUEJHAKY-REYDLGKFSA-N |
| XLogP | 1.72 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|