C11H19NO6S — CID 159737319
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;N-hydroxyformamide (PubChem CID 159737319) has the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;N-hydroxyformamide.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;N-hydroxyformamide |
|---|---|
| PubChem CID | 159737319 |
| Molecular Formula | C11H19NO6S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;N-hydroxyformamide |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.O=CNO |
| InChI | InChI=1S/C10H16O4S.CH3NO2/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;3-1-2-4/h7H,3-6H2,1-2H3,(H,12,13,14);1,4H,(H,2,3) |
| InChIKey | NBZQDGBWTBHXLM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|