C20H33IO5S — CID 158272056
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;1-(iodomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 158272056) has the molecular formula C20H33IO5S and a molecular weight of 512.45 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;1-(iodomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;1-(iodomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 158272056 |
| Molecular Formula | C20H33IO5S |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;1-(iodomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)C2CCC1(CI)C(O)C2.CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2 |
| InChI | InChI=1S/C10H17IO.C10H16O4S/c1-9(2)7-3-4-10(9,6-11)8(12)5-7;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7-8,12H,3-6H2,1-2H3;7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | GJDURLWRUVWMSG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|