C16H18I2O7S2 — CID 177131525
4-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2,6-diiodobenzenesulfonic acid (PubChem CID 177131525) has the molecular formula C16H18I2O7S2 and a molecular weight of 640.26 g/mol. Its IUPAC name is 4-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2,6-diiodobenzenesulfonic acid.
| Compound Name | 4-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2,6-diiodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177131525 |
| Molecular Formula | C16H18I2O7S2 |
| Molecular Weight | 640.26 g/mol |
| Exact Mass | 639.86 |
| IUPAC Name | 4-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2,6-diiodobenzenesulfonic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)Oc1cc(I)c(S(=O)(=O)O)c(I)c1)C(=O)C2 |
| InChI | InChI=1S/C16H18I2O7S2/c1-15(2)9-3-4-16(15,13(19)5-9)8-26(20,21)25-10-6-11(17)14(12(18)7-10)27(22,23)24/h6-7,9H,3-5,8H2,1-2H3,(H,22,23,24) |
| InChIKey | LRQDZJXBOFRXSQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|