C32H39O4S2+ — CID 22593363
(4-tert-butylphenyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;diphenylsulfanium (PubChem CID 22593363) has the molecular formula C32H39O4S2+ and a molecular weight of 551.79 g/mol. Its IUPAC name is (4-tert-butylphenyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;diphenylsulfanium.
| Compound Name | (4-tert-butylphenyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;diphenylsulfanium |
|---|---|
| PubChem CID | 22593363 |
| Molecular Formula | C32H39O4S2+ |
| Molecular Weight | 551.79 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | (4-tert-butylphenyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;diphenylsulfanium |
| SMILES | CC(C)(C)c1ccc(OS(=O)(=O)CC23CCC(CC2=O)C3(C)C)cc1.c1ccc([SH+]c2ccccc2)cc1 |
| InChI | InChI=1S/C20H28O4S.C12H10S/c1-18(2,3)14-6-8-16(9-7-14)24-25(22,23)13-20-11-10-15(12-17(20)21)19(20,4)5;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h6-9,15H,10-13H2,1-5H3;1-10H/p+1 |
| InChIKey | JIKHCOBXFZREFK-UHFFFAOYSA-O |
| XLogP | 7.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.79 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|