C18H22O5S2 — CID 139974936
phenacylsulfanyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 139974936) has the molecular formula C18H22O5S2 and a molecular weight of 382.50 g/mol. Its IUPAC name is phenacylsulfanyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | phenacylsulfanyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 139974936 |
| Molecular Formula | C18H22O5S2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | phenacylsulfanyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)OSCC(=O)c1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C18H22O5S2/c1-17(2)14-8-9-18(17,16(20)10-14)12-25(21,22)23-24-11-15(19)13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3 |
| InChIKey | ILTCWSMTWACOGP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|