C30H36O4S2 — CID 174661035
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;ethyl(triphenyl)-λ4-sulfane (PubChem CID 174661035) has the molecular formula C30H36O4S2 and a molecular weight of 524.75 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;ethyl(triphenyl)-λ4-sulfane.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;ethyl(triphenyl)-λ4-sulfane |
|---|---|
| PubChem CID | 174661035 |
| Molecular Formula | C30H36O4S2 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;ethyl(triphenyl)-λ4-sulfane |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.CCS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20S.C10H16O4S/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h3-17H,2H2,1H3;7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | BDHPUXOANBKPOH-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|