C22H29NO4S — CID 44519175
[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;2-propylquinoline (PubChem CID 44519175) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is [(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;2-propylquinoline.
| Compound Name | [(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;2-propylquinoline |
|---|---|
| PubChem CID | 44519175 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;2-propylquinoline |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)O)C(=O)C2.CCCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C12H13N.C10H16O4S/c1-2-5-11-9-8-10-6-3-4-7-12(10)13-11;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h3-4,6-9H,2,5H2,1H3;7H,3-6H2,1-2H3,(H,12,13,14)/t;7-,10-/m.0/s1 |
| InChIKey | JBKKXLLXIWMHGV-JAGIHPHKSA-N |
| XLogP | 4.46 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|