C28H36N2O5S — CID 3246666
[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;N-[(2R,6S)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine (PubChem CID 3246666) has the molecular formula C28H36N2O5S and a molecular weight of 512.67 g/mol. Its IUPAC name is [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;N-[(2R,6S)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;N-[(2R,6S)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 3246666 |
| Molecular Formula | C28H36N2O5S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;N-[(2R,6S)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2.CN1[C@@H](c2ccccc2)C/C(=N/O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O.C10H16O4S/c1-20-17(14-8-4-2-5-9-14)12-16(19-21)13-18(20)15-10-6-3-7-11-15;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h2-11,17-18,21H,12-13H2,1H3;7H,3-6H2,1-2H3,(H,12,13,14)/b19-16-;/t17-,18+;7-,10-/m11/s1 |
| InChIKey | IULVGBAEZJLGBY-IBEOQYEPSA-N |
| XLogP | 5.29 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|