About N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine
N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine (PubChem CID 873157) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine |
| PubChem CID | 873157 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine |
| SMILES | CN1[C@@H](c2ccccc2)C/C(=N/O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c1-20-17(14-8-4-2-5-9-14)12-16(19-21)13-18(20)15-10-6-3-7-11-15/h2-11,17-18,21H,12-13H2,1H3/b19-16-/t17-,18+/m1/s1 |
| InChIKey | PBJCHMDKVHLZPM-BODOZKESSA-N |
| XLogP | 4.02 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine?
The IUPAC name of N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine (CID 873157) is N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine.
What is the SMILES notation for N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine?
The canonical SMILES for N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine is CN1[C@@H](c2ccccc2)C/C(=N/O)C[C@H]1c1ccccc1.
What is the InChIKey of N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine?
The InChIKey is PBJCHMDKVHLZPM-BODOZKESSA-N. The full InChI is InChI=1S/C18H20N2O/c1-20-17(14-8-4-2-5-9-14)12-16(19-21)13-18(20)15-10-6-3-7-11-15/h2-11,17-18,21H,12-13H2,1H3/b19-16-/t17-,18+/m1/s1.
What are the key properties of N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine?
N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine has a molecular weight of 280.37 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,6R)-1-methyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine is sourced from PubChem (CID 873157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).