C24H24N2O — CID 11894630
(NZ)-N-[(2R,3R,6S)-1-methyl-2,3,6-triphenylpiperidin-4-ylidene]hydroxylamine (PubChem CID 11894630) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is (NZ)-N-[(2R,3R,6S)-1-methyl-2,3,6-triphenylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2R,3R,6S)-1-methyl-2,3,6-triphenylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 11894630 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (NZ)-N-[(2R,3R,6S)-1-methyl-2,3,6-triphenylpiperidin-4-ylidene]hydroxylamine |
| SMILES | CN1[C@H](c2ccccc2)C/C(=N/O)[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H24N2O/c1-26-22(18-11-5-2-6-12-18)17-21(25-27)23(19-13-7-3-8-14-19)24(26)20-15-9-4-10-16-20/h2-16,22-24,27H,17H2,1H3/b25-21-/t22-,23-,24-/m0/s1 |
| InChIKey | IZKDZFQLDMSHKG-SRCLYBRXSA-N |
| XLogP | 5.42 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|