C25H23NO2 — CID 11894627
(2R,3S,6S)-1-acetyl-2,3,6-triphenylpiperidin-4-one (PubChem CID 11894627) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is (2R,3S,6S)-1-acetyl-2,3,6-triphenylpiperidin-4-one.
| Compound Name | (2R,3S,6S)-1-acetyl-2,3,6-triphenylpiperidin-4-one |
|---|---|
| PubChem CID | 11894627 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (2R,3S,6S)-1-acetyl-2,3,6-triphenylpiperidin-4-one |
| SMILES | CC(=O)N1[C@H](c2ccccc2)CC(=O)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H23NO2/c1-18(27)26-22(19-11-5-2-6-12-19)17-23(28)24(20-13-7-3-8-14-20)25(26)21-15-9-4-10-16-21/h2-16,22,24-25H,17H2,1H3/t22-,24+,25-/m0/s1 |
| InChIKey | BHCVEZXVFMWSNG-CAOCKLPOSA-N |
| XLogP | 5.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |