C21H21Cl2NO2 — CID 139085589
(2S,3R,6R)-1-(2,2-dichloroacetyl)-3-ethyl-2,6-diphenylpiperidin-4-one (PubChem CID 139085589) has the molecular formula C21H21Cl2NO2 and a molecular weight of 390.31 g/mol. Its IUPAC name is (2S,3R,6R)-1-(2,2-dichloroacetyl)-3-ethyl-2,6-diphenylpiperidin-4-one.
| Compound Name | (2S,3R,6R)-1-(2,2-dichloroacetyl)-3-ethyl-2,6-diphenylpiperidin-4-one |
|---|---|
| PubChem CID | 139085589 |
| Molecular Formula | C21H21Cl2NO2 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (2S,3R,6R)-1-(2,2-dichloroacetyl)-3-ethyl-2,6-diphenylpiperidin-4-one |
| SMILES | CC[C@H]1C(=O)C[C@H](c2ccccc2)N(C(=O)C(Cl)Cl)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21Cl2NO2/c1-2-16-18(25)13-17(14-9-5-3-6-10-14)24(21(26)20(22)23)19(16)15-11-7-4-8-12-15/h3-12,16-17,19-20H,2,13H2,1H3/t16-,17+,19+/m0/s1 |
| InChIKey | OJJVBECEMMPQFP-YQVWRLOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|