C25H31N3O2 — CID 25270970
3-methyl-1-[2-(4-methylpiperazin-1-yl)acetyl]-2,6-diphenylpiperidin-4-one (PubChem CID 25270970) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-methyl-1-[2-(4-methylpiperazin-1-yl)acetyl]-2,6-diphenylpiperidin-4-one.
| Compound Name | 3-methyl-1-[2-(4-methylpiperazin-1-yl)acetyl]-2,6-diphenylpiperidin-4-one |
|---|---|
| PubChem CID | 25270970 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3-methyl-1-[2-(4-methylpiperazin-1-yl)acetyl]-2,6-diphenylpiperidin-4-one |
| SMILES | CC1C(=O)CC(c2ccccc2)N(C(=O)CN2CCN(C)CC2)C1c1ccccc1 |
| InChI | InChI=1S/C25H31N3O2/c1-19-23(29)17-22(20-9-5-3-6-10-20)28(25(19)21-11-7-4-8-12-21)24(30)18-27-15-13-26(2)14-16-27/h3-12,19,22,25H,13-18H2,1-2H3 |
| InChIKey | JXTBNRSUDIFCMY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |