C20H22N2O2 — CID 95907396
N-[(2R,3R,6S)-1-methyl-4-oxo-2,6-diphenylpiperidin-3-yl]acetamide (PubChem CID 95907396) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(2R,3R,6S)-1-methyl-4-oxo-2,6-diphenylpiperidin-3-yl]acetamide.
| Compound Name | N-[(2R,3R,6S)-1-methyl-4-oxo-2,6-diphenylpiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 95907396 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[(2R,3R,6S)-1-methyl-4-oxo-2,6-diphenylpiperidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(=O)C[C@@H](c2ccccc2)N(C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-14(23)21-19-18(24)13-17(15-9-5-3-6-10-15)22(2)20(19)16-11-7-4-8-12-16/h3-12,17,19-20H,13H2,1-2H3,(H,21,23)/t17-,19-,20+/m0/s1 |
| InChIKey | JDYAEPOVCTZWTD-YSIASYRMSA-N |
| XLogP | 2.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |