C19H23NO — CID 2729803
1,3-dimethyl-2,6-diphenylpiperidin-4-ol (PubChem CID 2729803) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 1,3-dimethyl-2,6-diphenylpiperidin-4-ol.
| Compound Name | 1,3-dimethyl-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 2729803 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1,3-dimethyl-2,6-diphenylpiperidin-4-ol |
| SMILES | CC1C(O)CC(c2ccccc2)N(C)C1c1ccccc1 |
| InChI | InChI=1S/C19H23NO/c1-14-18(21)13-17(15-9-5-3-6-10-15)20(2)19(14)16-11-7-4-8-12-16/h3-12,14,17-19,21H,13H2,1-2H3 |
| InChIKey | FAHFBUDMUKEFDS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |