C21H28ClNO — CID 44661232
1-methyl-2,6-diphenyl-3-propylpiperidin-4-ol;hydrochloride (PubChem CID 44661232) has the molecular formula C21H28ClNO and a molecular weight of 345.91 g/mol. Its IUPAC name is 1-methyl-2,6-diphenyl-3-propylpiperidin-4-ol;hydrochloride.
| Compound Name | 1-methyl-2,6-diphenyl-3-propylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 44661232 |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-methyl-2,6-diphenyl-3-propylpiperidin-4-ol;hydrochloride |
| SMILES | CCCC1C(O)CC(c2ccccc2)N(C)C1c1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO.ClH/c1-3-10-18-20(23)15-19(16-11-6-4-7-12-16)22(2)21(18)17-13-8-5-9-14-17;/h4-9,11-14,18-21,23H,3,10,15H2,1-2H3;1H |
| InChIKey | AIWQNPCWPQLURQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |