C29H35NO — CID 51411847
(2R,3R,4R,6S)-1-methyl-3-pentyl-2,4,6-triphenylpiperidin-4-ol (PubChem CID 51411847) has the molecular formula C29H35NO and a molecular weight of 413.61 g/mol. Its IUPAC name is (2R,3R,4R,6S)-1-methyl-3-pentyl-2,4,6-triphenylpiperidin-4-ol.
| Compound Name | (2R,3R,4R,6S)-1-methyl-3-pentyl-2,4,6-triphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 51411847 |
| Molecular Formula | C29H35NO |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (2R,3R,4R,6S)-1-methyl-3-pentyl-2,4,6-triphenylpiperidin-4-ol |
| SMILES | CCCCC[C@@H]1C(c2ccccc2)N(C)[C@H](c2ccccc2)C[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C29H35NO/c1-3-4-8-21-26-28(24-17-11-6-12-18-24)30(2)27(23-15-9-5-10-16-23)22-29(26,31)25-19-13-7-14-20-25/h5-7,9-20,26-28,31H,3-4,8,21-22H2,1-2H3/t26-,27+,28?,29+/m1/s1 |
| InChIKey | PDXVYZCYGBPUAD-PZZOVLDTSA-N |
| XLogP | 6.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|