C20H21NO — CID 95906179
(2S,6S)-4-ethynyl-1-methyl-2,6-diphenylpiperidin-4-ol (PubChem CID 95906179) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (2S,6S)-4-ethynyl-1-methyl-2,6-diphenylpiperidin-4-ol.
| Compound Name | (2S,6S)-4-ethynyl-1-methyl-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 95906179 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2S,6S)-4-ethynyl-1-methyl-2,6-diphenylpiperidin-4-ol |
| SMILES | C#CC1(O)C[C@@H](c2ccccc2)N(C)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H21NO/c1-3-20(22)14-18(16-10-6-4-7-11-16)21(2)19(15-20)17-12-8-5-9-13-17/h1,4-13,18-19,22H,14-15H2,2H3/t18-,19-/m0/s1 |
| InChIKey | PWVICUJDTDASAC-OALUTQOASA-N |
| XLogP | 3.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|