C14H18 — CID 155932132
[(1R,2S)-2-methyl-2-(2-methylprop-1-enyl)cyclopropyl]benzene (PubChem CID 155932132) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is [(1R,2S)-2-methyl-2-(2-methylprop-1-enyl)cyclopropyl]benzene.
| Compound Name | [(1R,2S)-2-methyl-2-(2-methylprop-1-enyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 155932132 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | [(1R,2S)-2-methyl-2-(2-methylprop-1-enyl)cyclopropyl]benzene |
| SMILES | CC(C)=C[C@]1(C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H18/c1-11(2)9-14(3)10-13(14)12-7-5-4-6-8-12/h4-9,13H,10H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | CBXPUIRUDWKGQJ-UONOGXRCSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|