C18H24O2 — CID 144670626
(2,2-dimethylcyclopropyl)benzene;(2E,4E)-hepta-2,4,6-triene-2,4-diol (PubChem CID 144670626) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (2,2-dimethylcyclopropyl)benzene;(2E,4E)-hepta-2,4,6-triene-2,4-diol.
| Compound Name | (2,2-dimethylcyclopropyl)benzene;(2E,4E)-hepta-2,4,6-triene-2,4-diol |
|---|---|
| PubChem CID | 144670626 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2,2-dimethylcyclopropyl)benzene;(2E,4E)-hepta-2,4,6-triene-2,4-diol |
| SMILES | C=C/C=C(O)\C=C(/C)O.CC1(C)CC1c1ccccc1 |
| InChI | InChI=1S/C11H14.C7H10O2/c1-11(2)8-10(11)9-6-4-3-5-7-9;1-3-4-7(9)5-6(2)8/h3-7,10H,8H2,1-2H3;3-5,8-9H,1H2,2H3/b;6-5+,7-4+ |
| InChIKey | HAXFBDPZQIJWJO-JAJJSRBKSA-N |
| XLogP | 5.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|