C12H16 — CID 144562671
1-[(1R)-2,2-dimethylcyclopropyl]-4-methylbenzene (PubChem CID 144562671) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-[(1R)-2,2-dimethylcyclopropyl]-4-methylbenzene.
| Compound Name | 1-[(1R)-2,2-dimethylcyclopropyl]-4-methylbenzene |
|---|---|
| PubChem CID | 144562671 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-[(1R)-2,2-dimethylcyclopropyl]-4-methylbenzene |
| SMILES | Cc1ccc([C@@H]2CC2(C)C)cc1 |
| InChI | InChI=1S/C12H16/c1-9-4-6-10(7-5-9)11-8-12(11,2)3/h4-7,11H,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | JDSRPCXZJRROJP-NSHDSACASA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |