C20H20N2O4 — CID 101168605
1-methyl-4-[(1R,2S)-2-[(1R,2S)-2-(4-methylphenyl)-1-nitrocyclopropyl]-2-nitrocyclopropyl]benzene (PubChem CID 101168605) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-methyl-4-[(1R,2S)-2-[(1R,2S)-2-(4-methylphenyl)-1-nitrocyclopropyl]-2-nitrocyclopropyl]benzene.
| Compound Name | 1-methyl-4-[(1R,2S)-2-[(1R,2S)-2-(4-methylphenyl)-1-nitrocyclopropyl]-2-nitrocyclopropyl]benzene |
|---|---|
| PubChem CID | 101168605 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-methyl-4-[(1R,2S)-2-[(1R,2S)-2-(4-methylphenyl)-1-nitrocyclopropyl]-2-nitrocyclopropyl]benzene |
| SMILES | Cc1ccc([C@H]2C[C@@]2([N+](=O)[O-])[C@@]2([N+](=O)[O-])C[C@H]2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-13-3-7-15(8-4-13)17-11-19(17,21(23)24)20(22(25)26)12-18(20)16-9-5-14(2)6-10-16/h3-10,17-18H,11-12H2,1-2H3/t17-,18+,19+,20- |
| InChIKey | JISCIICVTIGAFQ-JVSBHGNQSA-N |
| XLogP | 4.01 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|