C14H14N2O2 — CID 102148177
(1S,6R)-6-(4-methylphenyl)-1-nitrocyclohex-3-ene-1-carbonitrile (PubChem CID 102148177) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (1S,6R)-6-(4-methylphenyl)-1-nitrocyclohex-3-ene-1-carbonitrile.
| Compound Name | (1S,6R)-6-(4-methylphenyl)-1-nitrocyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 102148177 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (1S,6R)-6-(4-methylphenyl)-1-nitrocyclohex-3-ene-1-carbonitrile |
| SMILES | Cc1ccc([C@H]2CC=CC[C@]2(C#N)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H14N2O2/c1-11-5-7-12(8-6-11)13-4-2-3-9-14(13,10-15)16(17)18/h2-3,5-8,13H,4,9H2,1H3/t13-,14-/m1/s1 |
| InChIKey | IRLKSTHIUVHQQS-ZIAGYGMSSA-N |
| XLogP | 2.97 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|