C18H17BrN2 — CID 11359773
(3E,7Z)-10-(4-bromophenyl)cyclodeca-3,7-diene-1,1-dicarbonitrile (PubChem CID 11359773) has the molecular formula C18H17BrN2 and a molecular weight of 341.25 g/mol. Its IUPAC name is (3E,7Z)-10-(4-bromophenyl)cyclodeca-3,7-diene-1,1-dicarbonitrile.
| Compound Name | (3E,7Z)-10-(4-bromophenyl)cyclodeca-3,7-diene-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 11359773 |
| Molecular Formula | C18H17BrN2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (3E,7Z)-10-(4-bromophenyl)cyclodeca-3,7-diene-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)C/C=C/CC/C=C\CC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrN2/c19-16-10-8-15(9-11-16)17-7-5-3-1-2-4-6-12-18(17,13-20)14-21/h3-6,8-11,17H,1-2,7,12H2/b5-3-,6-4+ |
| InChIKey | HEFIMOVLHOXKKA-CIIODKQPSA-N |
| XLogP | 5.25 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|