C14H15N — CID 135037492
(1R,6R)-1-methyl-6-phenylcyclohex-3-ene-1-carbonitrile (PubChem CID 135037492) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is (1R,6R)-1-methyl-6-phenylcyclohex-3-ene-1-carbonitrile.
| Compound Name | (1R,6R)-1-methyl-6-phenylcyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 135037492 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (1R,6R)-1-methyl-6-phenylcyclohex-3-ene-1-carbonitrile |
| SMILES | C[C@@]1(C#N)CC=CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H15N/c1-14(11-15)10-6-5-9-13(14)12-7-3-2-4-8-12/h2-8,13H,9-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | MCOQYTPHYWVJJS-KGLIPLIRSA-N |
| XLogP | 3.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|