C20H19NO — CID 69303844
1-methyl-4-oxo-2,6-diphenylcyclohexane-1-carbonitrile (PubChem CID 69303844) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-methyl-4-oxo-2,6-diphenylcyclohexane-1-carbonitrile.
| Compound Name | 1-methyl-4-oxo-2,6-diphenylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 69303844 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-methyl-4-oxo-2,6-diphenylcyclohexane-1-carbonitrile |
| SMILES | CC1(C#N)C(c2ccccc2)CC(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C20H19NO/c1-20(14-21)18(15-8-4-2-5-9-15)12-17(22)13-19(20)16-10-6-3-7-11-16/h2-11,18-19H,12-13H2,1H3 |
| InChIKey | HABLUVCPVXRFFQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |