C20H19BrN2O4 — CID 177397861
diethyl 2-[4-(4-bromophenyl)-3,3-dicyanocyclopentylidene]propanedioate (PubChem CID 177397861) has the molecular formula C20H19BrN2O4 and a molecular weight of 431.29 g/mol. Its IUPAC name is diethyl 2-[4-(4-bromophenyl)-3,3-dicyanocyclopentylidene]propanedioate.
| Compound Name | diethyl 2-[4-(4-bromophenyl)-3,3-dicyanocyclopentylidene]propanedioate |
|---|---|
| PubChem CID | 177397861 |
| Molecular Formula | C20H19BrN2O4 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | diethyl 2-[4-(4-bromophenyl)-3,3-dicyanocyclopentylidene]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1CC(c2ccc(Br)cc2)C(C#N)(C#N)C1 |
| InChI | InChI=1S/C20H19BrN2O4/c1-3-26-18(24)17(19(25)27-4-2)14-9-16(20(10-14,11-22)12-23)13-5-7-15(21)8-6-13/h5-8,16H,3-4,9-10H2,1-2H3 |
| InChIKey | MPBJJLQMHOCTCV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|