C11H9BrO4 — CID 132514672
ethyl 3-(4-bromophenyl)-2,3-dioxopropanoate (PubChem CID 132514672) has the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-2,3-dioxopropanoate.
| Compound Name | ethyl 3-(4-bromophenyl)-2,3-dioxopropanoate |
|---|---|
| PubChem CID | 132514672 |
| Molecular Formula | C11H9BrO4 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-2,3-dioxopropanoate |
| SMILES | CCOC(=O)C(=O)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H9BrO4/c1-2-16-11(15)10(14)9(13)7-3-5-8(12)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | JUNWOMQWNJQWOF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|