C14H15BrN2O4 — CID 135440907
ethyl (E)-2-[(E)-[(4-bromobenzoyl)hydrazinylidene]methyl]-3-hydroxybut-2-enoate (PubChem CID 135440907) has the molecular formula C14H15BrN2O4 and a molecular weight of 355.19 g/mol. Its IUPAC name is ethyl (E)-2-[(E)-[(4-bromobenzoyl)hydrazinylidene]methyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-2-[(E)-[(4-bromobenzoyl)hydrazinylidene]methyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135440907 |
| Molecular Formula | C14H15BrN2O4 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | ethyl (E)-2-[(E)-[(4-bromobenzoyl)hydrazinylidene]methyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/C=N/NC(=O)c1ccc(Br)cc1)=C(\C)O |
| InChI | InChI=1S/C14H15BrN2O4/c1-3-21-14(20)12(9(2)18)8-16-17-13(19)10-4-6-11(15)7-5-10/h4-8,18H,3H2,1-2H3,(H,17,19)/b12-9+,16-8+ |
| InChIKey | SMXWUDWNFLGJEK-JWSKOIFUSA-N |
| XLogP | 2.56 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|