C13H15NO3 — CID 135534056
ethyl 3-hydroxy-2-(phenyliminomethyl)but-2-enoate (PubChem CID 135534056) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-(phenyliminomethyl)but-2-enoate.
| Compound Name | ethyl 3-hydroxy-2-(phenyliminomethyl)but-2-enoate |
|---|---|
| PubChem CID | 135534056 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | ethyl 3-hydroxy-2-(phenyliminomethyl)but-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccccc1)=C(C)O |
| InChI | InChI=1S/C13H15NO3/c1-3-17-13(16)12(10(2)15)9-14-11-7-5-4-6-8-11/h4-9,15H,3H2,1-2H3/b12-10?,14-9+ |
| InChIKey | UPCKBAIRQLZNKA-QYSDINMBSA-N |
| XLogP | 2.78 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|