C21H22ClNO3 — CID 135611085
ethyl (Z)-3-(2-chlorophenyl)-3-hydroxy-2-[(4-propan-2-ylphenyl)iminomethyl]prop-2-enoate (PubChem CID 135611085) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is ethyl (Z)-3-(2-chlorophenyl)-3-hydroxy-2-[(4-propan-2-ylphenyl)iminomethyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(2-chlorophenyl)-3-hydroxy-2-[(4-propan-2-ylphenyl)iminomethyl]prop-2-enoate |
|---|---|
| PubChem CID | 135611085 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | ethyl (Z)-3-(2-chlorophenyl)-3-hydroxy-2-[(4-propan-2-ylphenyl)iminomethyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(C(C)C)cc1)=C(\O)c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClNO3/c1-4-26-21(25)18(20(24)17-7-5-6-8-19(17)22)13-23-16-11-9-15(10-12-16)14(2)3/h5-14,24H,4H2,1-3H3/b20-18-,23-13+ |
| InChIKey | RIJWYDNFBJKZFM-JEPHLZCVSA-N |
| XLogP | 5.70 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|