C23H17Cl2FN2O3 — CID 135546184
ethyl (Z)-2-[(3,4-dichlorophenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate (PubChem CID 135546184) has the molecular formula C23H17Cl2FN2O3 and a molecular weight of 459.30 g/mol. Its IUPAC name is ethyl (Z)-2-[(3,4-dichlorophenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-[(3,4-dichlorophenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135546184 |
| Molecular Formula | C23H17Cl2FN2O3 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | ethyl (Z)-2-[(3,4-dichlorophenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(Cl)c(Cl)c1)=C(\O)c1ccc(-c2ccncc2)cc1F |
| InChI | InChI=1S/C23H17Cl2FN2O3/c1-2-31-23(30)18(13-28-16-4-6-19(24)20(25)12-16)22(29)17-5-3-15(11-21(17)26)14-7-9-27-10-8-14/h3-13,29H,2H2,1H3/b22-18-,28-13+ |
| InChIKey | LRWNOKXOPXRFAU-BXCAIUMKSA-N |
| XLogP | 6.43 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|