C23H18F2N2O3 — CID 135543737
ethyl (Z)-2-[(2-fluorophenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate (PubChem CID 135543737) has the molecular formula C23H18F2N2O3 and a molecular weight of 408.40 g/mol. Its IUPAC name is ethyl (Z)-2-[(2-fluorophenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-[(2-fluorophenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135543737 |
| Molecular Formula | C23H18F2N2O3 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | ethyl (Z)-2-[(2-fluorophenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccccc1F)=C(\O)c1ccc(-c2ccncc2)cc1F |
| InChI | InChI=1S/C23H18F2N2O3/c1-2-30-23(29)18(14-27-21-6-4-3-5-19(21)24)22(28)17-8-7-16(13-20(17)25)15-9-11-26-12-10-15/h3-14,28H,2H2,1H3/b22-18-,27-14+ |
| InChIKey | KKFXAAGFFZXZBO-QUWHXMCLSA-N |
| XLogP | 5.26 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|