C26H17F4NO4 — CID 135520324
ethyl (E)-3-hydroxy-2-[(3-hydroxyphenanthren-2-yl)iminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate (PubChem CID 135520324) has the molecular formula C26H17F4NO4 and a molecular weight of 483.42 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-[(3-hydroxyphenanthren-2-yl)iminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-2-[(3-hydroxyphenanthren-2-yl)iminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135520324 |
| Molecular Formula | C26H17F4NO4 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-[(3-hydroxyphenanthren-2-yl)iminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1cc2ccc3ccccc3c2cc1O)=C(/O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H17F4NO4/c1-2-35-26(34)18(25(33)17-10-19(27)23(29)24(30)22(17)28)12-31-20-9-14-8-7-13-5-3-4-6-15(13)16(14)11-21(20)32/h3-12,32-33H,2H2,1H3/b25-18+,31-12+ |
| InChIKey | WXKUPFIDUWSVQI-ZSPHXXEDSA-N |
| XLogP | 6.49 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|