C22H21F4NO4 — CID 135737434
ethyl (E)-2-[(5-tert-butyl-2-hydroxyphenyl)iminomethyl]-3-hydroxy-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate (PubChem CID 135737434) has the molecular formula C22H21F4NO4 and a molecular weight of 439.41 g/mol. Its IUPAC name is ethyl (E)-2-[(5-tert-butyl-2-hydroxyphenyl)iminomethyl]-3-hydroxy-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-[(5-tert-butyl-2-hydroxyphenyl)iminomethyl]-3-hydroxy-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135737434 |
| Molecular Formula | C22H21F4NO4 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | ethyl (E)-2-[(5-tert-butyl-2-hydroxyphenyl)iminomethyl]-3-hydroxy-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1cc(C(C)(C)C)ccc1O)=C(/O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H21F4NO4/c1-5-31-21(30)13(20(29)12-9-14(23)18(25)19(26)17(12)24)10-27-15-8-11(22(2,3)4)6-7-16(15)28/h6-10,28-29H,5H2,1-4H3/b20-13+,27-10+ |
| InChIKey | BJDRYHGPHBNSMX-MZMHWRLVSA-N |
| XLogP | 5.48 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|