C21H15F3N2O3 — CID 135464528
ethyl (E)-3-hydroxy-2-(quinolin-5-yliminomethyl)-3-(2,4,5-trifluorophenyl)prop-2-enoate (PubChem CID 135464528) has the molecular formula C21H15F3N2O3 and a molecular weight of 400.36 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-(quinolin-5-yliminomethyl)-3-(2,4,5-trifluorophenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-2-(quinolin-5-yliminomethyl)-3-(2,4,5-trifluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135464528 |
| Molecular Formula | C21H15F3N2O3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-(quinolin-5-yliminomethyl)-3-(2,4,5-trifluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1cccc2ncccc12)=C(/O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H15F3N2O3/c1-2-29-21(28)14(20(27)13-9-16(23)17(24)10-15(13)22)11-26-19-7-3-6-18-12(19)5-4-8-25-18/h3-11,27H,2H2,1H3/b20-14+,26-11+ |
| InChIKey | RZTOZZICAKCGAQ-YKVLMGGDSA-N |
| XLogP | 4.89 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|