C17H12F4N2O3 — CID 135499059
ethyl (E)-2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate (PubChem CID 135499059) has the molecular formula C17H12F4N2O3 and a molecular weight of 368.29 g/mol. Its IUPAC name is ethyl (E)-2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135499059 |
| Molecular Formula | C17H12F4N2O3 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | ethyl (E)-2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(F)cn1)=C(/O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H12F4N2O3/c1-2-26-17(25)11(8-23-15-4-3-9(18)7-22-15)16(24)10-5-13(20)14(21)6-12(10)19/h3-8,24H,2H2,1H3/b16-11+,23-8+ |
| InChIKey | RSYZKIJPUVSQDC-HIZGUPRWSA-N |
| XLogP | 3.87 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|