C16H12Cl2FN3O3 — CID 135432260
ethyl (Z)-3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-[(E)-pyridin-2-yliminomethyl]prop-2-enoate (PubChem CID 135432260) has the molecular formula C16H12Cl2FN3O3 and a molecular weight of 384.19 g/mol. Its IUPAC name is ethyl (Z)-3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-[(E)-pyridin-2-yliminomethyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-[(E)-pyridin-2-yliminomethyl]prop-2-enoate |
|---|---|
| PubChem CID | 135432260 |
| Molecular Formula | C16H12Cl2FN3O3 |
| Molecular Weight | 384.19 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | ethyl (Z)-3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-[(E)-pyridin-2-yliminomethyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccccn1)=C(\O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C16H12Cl2FN3O3/c1-2-25-16(24)10(8-21-12-5-3-4-6-20-12)13(23)9-7-11(19)15(18)22-14(9)17/h3-8,23H,2H2,1H3/b13-10-,21-8+ |
| InChIKey | NPDABRGMMQATEF-KISFZOSGSA-N |
| XLogP | 4.16 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.19 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|