C13H9Cl2FN4O3S — CID 149163245
ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-(1,3,4-thiadiazol-2-yliminomethyl)prop-2-enoate (PubChem CID 149163245) has the molecular formula C13H9Cl2FN4O3S and a molecular weight of 391.21 g/mol. Its IUPAC name is ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-(1,3,4-thiadiazol-2-yliminomethyl)prop-2-enoate.
| Compound Name | ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-(1,3,4-thiadiazol-2-yliminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 149163245 |
| Molecular Formula | C13H9Cl2FN4O3S |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-(1,3,4-thiadiazol-2-yliminomethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(C=Nc1nncs1)=C(O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C13H9Cl2FN4O3S/c1-2-23-12(22)7(4-17-13-20-18-5-24-13)9(21)6-3-8(16)11(15)19-10(6)14/h3-5,21H,2H2,1H3 |
| InChIKey | ZKTRWAOIYOWEHL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|